C28H31N7 — CID 75201685
6-(3-benzyl-1-methylindol-2-yl)-3-methyl-N-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-8-amine (PubChem CID 75201685) has the molecular formula C28H31N7 and a molecular weight of 465.61 g/mol. Its IUPAC name is 6-(3-benzyl-1-methylindol-2-yl)-3-methyl-N-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-8-amine.
| Compound Name | 6-(3-benzyl-1-methylindol-2-yl)-3-methyl-N-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 75201685 |
| Molecular Formula | C28H31N7 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 6-(3-benzyl-1-methylindol-2-yl)-3-methyl-N-(1-methylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
| SMILES | Cc1nnc2c(NC3CCN(C)CC3)cc(-c3c(Cc4ccccc4)c4ccccc4n3C)nn12 |
| InChI | InChI=1S/C28H31N7/c1-19-30-31-28-25(29-21-13-15-33(2)16-14-21)18-24(32-35(19)28)27-23(17-20-9-5-4-6-10-20)22-11-7-8-12-26(22)34(27)3/h4-12,18,21,29H,13-17H2,1-3H3 |
| InChIKey | IRZRXORHLMPRLJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|