About 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine
4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine (PubChem CID 75201959) has the molecular formula C19H14FN3O2
and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine |
| PubChem CID | 75201959 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine |
| SMILES | Cc1ncnc(C)c1-c1ccc(Oc2nccc3occc23)c(F)c1 |
| InChI | InChI=1S/C19H14FN3O2/c1-11-18(12(2)23-10-22-11)13-3-4-17(15(20)9-13)25-19-14-6-8-24-16(14)5-7-21-19/h3-10H,1-2H3 |
| InChIKey | VZRNWKPTHQSPNW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine?
The IUPAC name of 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine (CID 75201959) is 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine.
What is the SMILES notation for 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine?
The canonical SMILES for 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine is Cc1ncnc(C)c1-c1ccc(Oc2nccc3occc23)c(F)c1.
What is the InChIKey of 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine?
The InChIKey is VZRNWKPTHQSPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3O2/c1-11-18(12(2)23-10-22-11)13-3-4-17(15(20)9-13)25-19-14-6-8-24-16(14)5-7-21-19/h3-10H,1-2H3.
What are the key properties of 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine?
4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine has a molecular weight of 335.34 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]furo[3,2-c]pyridine is sourced from PubChem (CID 75201959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).