C22H24N4O2S — CID 75201981
3-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methylidene]piperidin-1-yl]-3-oxoprop-1-enyl]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 75201981) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 3-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methylidene]piperidin-1-yl]-3-oxoprop-1-enyl]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 3-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methylidene]piperidin-1-yl]-3-oxoprop-1-enyl]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 75201981 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methylidene]piperidin-1-yl]-3-oxoprop-1-enyl]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | Cc1nc(C=C2CCN(C(=O)/C=C/c3cnc4c(c3)CCCC(=O)N4)CC2)cs1 |
| InChI | InChI=1S/C22H24N4O2S/c1-15-24-19(14-29-15)12-16-7-9-26(10-8-16)21(28)6-5-17-11-18-3-2-4-20(27)25-22(18)23-13-17/h5-6,11-14H,2-4,7-10H2,1H3,(H,23,25,27)/b6-5+ |
| InChIKey | YRXDCUZJLYJXDS-AATRIKPKSA-N |
| XLogP | 3.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|