About 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol
4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol (PubChem CID 75202110) has the molecular formula C24H22Cl3NO
and a molecular weight of 446.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol |
| PubChem CID | 75202110 |
| Molecular Formula | C24H22Cl3NO |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol |
| SMILES | CC1(NCc2cc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)c(Cl)c3)c2O)CCC1 |
| InChI | InChI=1S/C24H22Cl3NO/c1-24(9-2-10-24)28-14-18-11-17(15-3-6-19(25)7-4-15)12-20(23(18)29)16-5-8-21(26)22(27)13-16/h3-8,11-13,28-29H,2,9-10,14H2,1H3 |
| InChIKey | GYQPYGXOVGXTBD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol?
The IUPAC name of 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol (CID 75202110) is 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol.
What is the SMILES notation for 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol?
The canonical SMILES for 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol is CC1(NCc2cc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)c(Cl)c3)c2O)CCC1.
What is the InChIKey of 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol?
The InChIKey is GYQPYGXOVGXTBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl3NO/c1-24(9-2-10-24)28-14-18-11-17(15-3-6-19(25)7-4-15)12-20(23(18)29)16-5-8-21(26)22(27)13-16/h3-8,11-13,28-29H,2,9-10,14H2,1H3.
What are the key properties of 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol?
4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol has a molecular weight of 446.81 g/mol, XLogP of 7.72, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2-(3,4-dichlorophenyl)-6-[[(1-methylcyclobutyl)amino]methyl]phenol is sourced from PubChem (CID 75202110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).