C14H11ClN4O2 — CID 75202257
3-[(5-chloro-1-methylindazol-3-yl)amino]pyridine-4-carboxylic acid (PubChem CID 75202257) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 3-[(5-chloro-1-methylindazol-3-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-[(5-chloro-1-methylindazol-3-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 75202257 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-[(5-chloro-1-methylindazol-3-yl)amino]pyridine-4-carboxylic acid |
| SMILES | Cn1nc(Nc2cnccc2C(=O)O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H11ClN4O2/c1-19-12-3-2-8(15)6-10(12)13(18-19)17-11-7-16-5-4-9(11)14(20)21/h2-7H,1H3,(H,17,18)(H,20,21) |
| InChIKey | TXMBUJQSVXBAFZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |