C23H16Cl3F6IN2O2 — CID 75202474
2-iodo-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 75202474) has the molecular formula C23H16Cl3F6IN2O2 and a molecular weight of 699.64 g/mol. Its IUPAC name is 2-iodo-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-iodo-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 75202474 |
| Molecular Formula | C23H16Cl3F6IN2O2 |
| Molecular Weight | 699.64 g/mol |
| Exact Mass | 697.92 |
| IUPAC Name | 2-iodo-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | O=C(NC1(C(=O)NCC(F)(F)F)CC1)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1I |
| InChI | InChI=1S/C23H16Cl3F6IN2O2/c24-15-8-12(9-16(25)18(15)26)14(23(30,31)32)4-2-11-1-3-13(17(33)7-11)19(36)35-21(5-6-21)20(37)34-10-22(27,28)29/h1-4,7-9,14H,5-6,10H2,(H,34,37)(H,35,36)/b4-2+ |
| InChIKey | YIVSBCANLWECED-DUXPYHPUSA-N |
| XLogP | 7.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|