C23H18BrCl3F6N2O3 — CID 75202499
2-bromo-N-[(2R)-3-methoxy-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 75202499) has the molecular formula C23H18BrCl3F6N2O3 and a molecular weight of 670.66 g/mol. Its IUPAC name is 2-bromo-N-[(2R)-3-methoxy-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[(2R)-3-methoxy-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 75202499 |
| Molecular Formula | C23H18BrCl3F6N2O3 |
| Molecular Weight | 670.66 g/mol |
| Exact Mass | 667.95 |
| IUPAC Name | 2-bromo-N-[(2R)-3-methoxy-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | COC[C@@H](NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H18BrCl3F6N2O3/c1-38-9-18(21(37)34-10-22(28,29)30)35-20(36)13-4-2-11(6-15(13)24)3-5-14(23(31,32)33)12-7-16(25)19(27)17(26)8-12/h2-8,14,18H,9-10H2,1H3,(H,34,37)(H,35,36)/b5-3+/t14?,18-/m1/s1 |
| InChIKey | CPJFVMAEWRGKNT-NHFNKYQGSA-N |
| XLogP | 7.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|