C24H25N5O4 — CID 75202758
5-amino-3-[4-(3-methoxyphenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 75202758) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-amino-3-[4-(3-methoxyphenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(3-methoxyphenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75202758 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-amino-3-[4-(3-methoxyphenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](n2nc(-c3ccc(Oc4cccc(OC)c4)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C24H25N5O4/c1-3-20(30)28-12-11-16(14-28)29-23(25)21(24(26)31)22(27-29)15-7-9-17(10-8-15)33-19-6-4-5-18(13-19)32-2/h3-10,13,16H,1,11-12,14,25H2,2H3,(H2,26,31)/t16-/m1/s1 |
| InChIKey | ROFKRYXQFXVOQX-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|