C30H34F2N4O6 — CID 75202791
3-hydroxypropanoyloxymethyl 4-[(1R)-1-[5-[6-[[4-(difluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-2-pyridinyl]-1-hydroxyethyl]cyclohexane-1-carboxylate (PubChem CID 75202791) has the molecular formula C30H34F2N4O6 and a molecular weight of 584.62 g/mol. Its IUPAC name is 3-hydroxypropanoyloxymethyl 4-[(1R)-1-[5-[6-[[4-(difluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-2-pyridinyl]-1-hydroxyethyl]cyclohexane-1-carboxylate.
| Compound Name | 3-hydroxypropanoyloxymethyl 4-[(1R)-1-[5-[6-[[4-(difluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-2-pyridinyl]-1-hydroxyethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 75202791 |
| Molecular Formula | C30H34F2N4O6 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 3-hydroxypropanoyloxymethyl 4-[(1R)-1-[5-[6-[[4-(difluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-2-pyridinyl]-1-hydroxyethyl]cyclohexane-1-carboxylate |
| SMILES | Cc1cc(Nc2cc(C(F)F)ccn2)nc(-c2ccc([C@](C)(O)C3CCC(C(=O)OCOC(=O)CCO)CC3)nc2)c1 |
| InChI | InChI=1S/C30H34F2N4O6/c1-18-13-23(35-26(14-18)36-25-15-20(28(31)32)9-11-33-25)21-5-8-24(34-16-21)30(2,40)22-6-3-19(4-7-22)29(39)42-17-41-27(38)10-12-37/h5,8-9,11,13-16,19,22,28,37,40H,3-4,6-7,10,12,17H2,1-2H3,(H,33,35,36)/t19?,22?,30-/m1/s1 |
| InChIKey | KPBKTJMCJIDFAF-VHGCEYQQSA-N |
| XLogP | 4.97 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|