C15H11N7O2S2 — CID 75202820
12-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)-7λ6-thia-3,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),4,10,12-tetraene 7,7-dioxide (PubChem CID 75202820) has the molecular formula C15H11N7O2S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 12-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)-7λ6-thia-3,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),4,10,12-tetraene 7,7-dioxide.
| Compound Name | 12-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)-7λ6-thia-3,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),4,10,12-tetraene 7,7-dioxide |
|---|---|
| PubChem CID | 75202820 |
| Molecular Formula | C15H11N7O2S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 12-(5-pyridin-3-yl-1,3,4-thiadiazol-2-yl)-7λ6-thia-3,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),4,10,12-tetraene 7,7-dioxide |
| SMILES | O=S1(=O)Nc2ccc(-c3nnc(-c4cccnc4)s3)nc2C2NN=CC21 |
| InChI | InChI=1S/C15H11N7O2S2/c23-26(24)11-7-17-19-13(11)12-9(22-26)3-4-10(18-12)15-21-20-14(25-15)8-2-1-5-16-6-8/h1-7,11,13,19,22H |
| InChIKey | BZOICRAZGWPBQS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |