C17H12F3N3O2 — CID 75203005
8-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6-naphthyridine-2-carboxamide (PubChem CID 75203005) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 8-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6-naphthyridine-2-carboxamide.
| Compound Name | 8-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 75203005 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 8-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6-naphthyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc2cncc(-c3ccc(OCC(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)9-25-12-4-1-10(2-5-12)13-8-22-7-11-3-6-14(16(21)24)23-15(11)13/h1-8H,9H2,(H2,21,24) |
| InChIKey | LNSHZXHPVVZQIW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |