C15H9Cl2N3O — CID 75203010
8-(2,4-dichlorophenyl)-1,6-naphthyridine-2-carboxamide (PubChem CID 75203010) has the molecular formula C15H9Cl2N3O and a molecular weight of 318.16 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-1,6-naphthyridine-2-carboxamide.
| Compound Name | 8-(2,4-dichlorophenyl)-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 75203010 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-1,6-naphthyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc2cncc(-c3ccc(Cl)cc3Cl)c2n1 |
| InChI | InChI=1S/C15H9Cl2N3O/c16-9-2-3-10(12(17)5-9)11-7-19-6-8-1-4-13(15(18)21)20-14(8)11/h1-7H,(H2,18,21) |
| InChIKey | DQBWBYBFOJSAHU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |