C23H21F2N3O3 — CID 75203072
3-[3,5-difluoro-4-[5-(6-methoxy-4-methyl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenoxy]propan-1-ol (PubChem CID 75203072) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[5-(6-methoxy-4-methyl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenoxy]propan-1-ol.
| Compound Name | 3-[3,5-difluoro-4-[5-(6-methoxy-4-methyl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 75203072 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[3,5-difluoro-4-[5-(6-methoxy-4-methyl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenoxy]propan-1-ol |
| SMILES | COc1cc(C)c(-c2cnc3[nH]c(-c4c(F)cc(OCCCO)cc4F)cc3c2)cn1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-13-6-21(30-2)26-12-17(13)15-7-14-8-20(28-23(14)27-11-15)22-18(24)9-16(10-19(22)25)31-5-3-4-29/h6-12,29H,3-5H2,1-2H3,(H,27,28) |
| InChIKey | RGEXIPKRMURWHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|