C25H28N6O3 — CID 75203145
5-[(2S)-2-[[7-[4-(dimethylamino)phenyl]pyrido[3,4-b]pyrazin-5-yl]oxymethyl]morpholin-4-yl]-5-oxopentanenitrile (PubChem CID 75203145) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 5-[(2S)-2-[[7-[4-(dimethylamino)phenyl]pyrido[3,4-b]pyrazin-5-yl]oxymethyl]morpholin-4-yl]-5-oxopentanenitrile.
| Compound Name | 5-[(2S)-2-[[7-[4-(dimethylamino)phenyl]pyrido[3,4-b]pyrazin-5-yl]oxymethyl]morpholin-4-yl]-5-oxopentanenitrile |
|---|---|
| PubChem CID | 75203145 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 5-[(2S)-2-[[7-[4-(dimethylamino)phenyl]pyrido[3,4-b]pyrazin-5-yl]oxymethyl]morpholin-4-yl]-5-oxopentanenitrile |
| SMILES | CN(C)c1ccc(-c2cc3nccnc3c(OC[C@@H]3CN(C(=O)CCCC#N)CCO3)n2)cc1 |
| InChI | InChI=1S/C25H28N6O3/c1-30(2)19-8-6-18(7-9-19)21-15-22-24(28-12-11-27-22)25(29-21)34-17-20-16-31(13-14-33-20)23(32)5-3-4-10-26/h6-9,11-12,15,20H,3-5,13-14,16-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | CACASQLGTXPJAR-FQEVSTJZSA-N |
| XLogP | 3.06 |
| TPSA | 104.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|