C33H53NO3 — CID 75203360
methyl (1R,3aS,5aR,5bR,9S,11aR)-9-acetamido-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate (PubChem CID 75203360) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is methyl (1R,3aS,5aR,5bR,9S,11aR)-9-acetamido-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate.
| Compound Name | methyl (1R,3aS,5aR,5bR,9S,11aR)-9-acetamido-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
|---|---|
| PubChem CID | 75203360 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | methyl (1R,3aS,5aR,5bR,9S,11aR)-9-acetamido-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
| SMILES | C=C(C)C1CC[C@]2(C(=O)OC)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@H](NC(C)=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C33H53NO3/c1-20(2)22-12-17-33(28(36)37-9)19-18-31(7)23(27(22)33)10-11-25-30(6)15-14-26(34-21(3)35)29(4,5)24(30)13-16-32(25,31)8/h22-27H,1,10-19H2,2-9H3,(H,34,35)/t22?,23?,24?,25?,26-,27?,30-,31+,32+,33-/m0/s1 |
| InChIKey | ZNFZXXWXMLNADG-RLFVTDMKSA-N |
| XLogP | 7.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|