C56H61FO5SSi2 — CID 75203585
(2S,3R,4R,5S,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 75203585) has the molecular formula C56H61FO5SSi2 and a molecular weight of 921.34 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (2S,3R,4R,5S,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 75203585 |
| Molecular Formula | C56H61FO5SSi2 |
| Molecular Weight | 921.34 g/mol |
| Exact Mass | 920.38 |
| IUPAC Name | (2S,3R,4R,5S,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](O)[C@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C56H61FO5SSi2/c1-39-28-29-41(36-42(39)37-44-34-35-50(63-44)40-30-32-43(57)33-31-40)52-54(62-65(56(5,6)7,47-24-16-10-17-25-47)48-26-18-11-19-27-48)51(59)53(49(38-58)60-52)61-64(55(2,3)4,45-20-12-8-13-21-45)46-22-14-9-15-23-46/h8-36,49,51-54,58-59H,37-38H2,1-7H3/t49-,51+,52+,53-,54-/m1/s1 |
| InChIKey | OQENLPPISARYDR-CCZHSJSNSA-N |
| XLogP | 10.14 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.34 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|