About 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile
4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile (PubChem CID 75203850) has the molecular formula C20H16F2N4
and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile |
| PubChem CID | 75203850 |
| Molecular Formula | C20H16F2N4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Nc1ccc(F)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H16F2N4/c1-12-9-14(11-23)10-13(2)19(12)25-18-8-7-17(22)20(26-18)24-16-5-3-15(21)4-6-16/h3-10H,1-2H3,(H2,24,25,26) |
| InChIKey | PQGVHADEBSVBQG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile (CID 75203850) is 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Nc1ccc(F)c(Nc2ccc(F)cc2)n1.
What is the InChIKey of 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile?
The InChIKey is PQGVHADEBSVBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N4/c1-12-9-14(11-23)10-13(2)19(12)25-18-8-7-17(22)20(26-18)24-16-5-3-15(21)4-6-16/h3-10H,1-2H3,(H2,24,25,26).
What are the key properties of 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile?
4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile has a molecular weight of 350.37 g/mol, XLogP of 5.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-fluoro-6-(4-fluoroanilino)-2-pyridinyl]amino]-3,5-dimethylbenzonitrile is sourced from PubChem (CID 75203850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).