C16H20FN3 — CID 75204033
1-[2-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]ethyl]piperidine (PubChem CID 75204033) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-[2-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]ethyl]piperidine.
| Compound Name | 1-[2-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 75204033 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-[2-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]ethyl]piperidine |
| SMILES | Fc1ccc(-c2[nH]ncc2CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C16H20FN3/c17-15-6-4-13(5-7-15)16-14(12-18-19-16)8-11-20-9-2-1-3-10-20/h4-7,12H,1-3,8-11H2,(H,18,19) |
| InChIKey | YUOLEJICQTVICH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |