C17H12FN5O3S — CID 7520426
6-(4-fluorophenyl)-3-[(4-nitrophenoxy)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 7520426) has the molecular formula C17H12FN5O3S and a molecular weight of 385.38 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-[(4-nitrophenoxy)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(4-fluorophenyl)-3-[(4-nitrophenoxy)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 7520426 |
| Molecular Formula | C17H12FN5O3S |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 6-(4-fluorophenyl)-3-[(4-nitrophenoxy)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | O=[N+]([O-])c1ccc(OCc2nnc3n2N=C(c2ccc(F)cc2)CS3)cc1 |
| InChI | InChI=1S/C17H12FN5O3S/c18-12-3-1-11(2-4-12)15-10-27-17-20-19-16(22(17)21-15)9-26-14-7-5-13(6-8-14)23(24)25/h1-8H,9-10H2 |
| InChIKey | ICBSCRQQJGYTHG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|