About [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea
[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea (PubChem CID 75207260) has the molecular formula C9H8ClN5O
and a molecular weight of 237.65 g/mol. Its IUPAC name is [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea.
Molecular Properties
| Compound Name | [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea |
| PubChem CID | 75207260 |
| Molecular Formula | C9H8ClN5O |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C9H8ClN5O/c10-8-6(5-12-14-9(11)16)15-4-2-1-3-7(15)13-8/h1-5H,(H3,11,14,16) |
| InChIKey | SWWGQXVGKPLDJX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea?
The IUPAC name of [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea (CID 75207260) is [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea.
What is the SMILES notation for [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea?
The canonical SMILES for [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea is NC(=O)NN=Cc1c(Cl)nc2ccccn12.
What is the InChIKey of [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea?
The InChIKey is SWWGQXVGKPLDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN5O/c10-8-6(5-12-14-9(11)16)15-4-2-1-3-7(15)13-8/h1-5H,(H3,11,14,16).
What are the key properties of [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea?
[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea has a molecular weight of 237.65 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-chloroimidazo[1,2-a]pyridin-3-yl)methylideneamino]urea is sourced from PubChem (CID 75207260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).