About [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate
[5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate (PubChem CID 75212442) has the molecular formula C17H20O7
and a molecular weight of 336.34 g/mol. Its IUPAC name is [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate |
| PubChem CID | 75212442 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OCc1c(OC)c(CO)c(C=CCO)oc1=O |
| InChI | InChI=1S/C17H20O7/c1-3-4-5-8-15(20)23-11-13-16(22-2)12(10-19)14(7-6-9-18)24-17(13)21/h3-8,18-19H,9-11H2,1-2H3 |
| InChIKey | UOMAGVHZSLPVJJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate?
The IUPAC name of [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate (CID 75212442) is [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate.
What is the SMILES notation for [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate?
The canonical SMILES for [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate is CC=CC=CC(=O)OCc1c(OC)c(CO)c(C=CCO)oc1=O.
What is the InChIKey of [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate?
The InChIKey is UOMAGVHZSLPVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O7/c1-3-4-5-8-15(20)23-11-13-16(22-2)12(10-19)14(7-6-9-18)24-17(13)21/h3-8,18-19H,9-11H2,1-2H3.
What are the key properties of [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate?
[5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate has a molecular weight of 336.34 g/mol, XLogP of 1.32, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-6-(3-hydroxyprop-1-enyl)-4-methoxy-2-oxopyran-3-yl]methyl hexa-2,4-dienoate is sourced from PubChem (CID 75212442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).