C33H42N4O9 — CID 75214747
methyl 2-amino-4-[[3-cyclohexyl-1-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,4-dioxo-1-phenylmethoxybutan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]benzoate (PubChem CID 75214747) has the molecular formula C33H42N4O9 and a molecular weight of 638.72 g/mol. Its IUPAC name is methyl 2-amino-4-[[3-cyclohexyl-1-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,4-dioxo-1-phenylmethoxybutan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 2-amino-4-[[3-cyclohexyl-1-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,4-dioxo-1-phenylmethoxybutan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 75214747 |
| Molecular Formula | C33H42N4O9 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | methyl 2-amino-4-[[3-cyclohexyl-1-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,4-dioxo-1-phenylmethoxybutan-2-yl]amino]-1-oxopropan-2-yl]carbamoyl]benzoate |
| SMILES | CCOC(=O)CNC(=O)C(=O)C(COCc1ccccc1)NC(=O)C(CC1CCCCC1)NC(=O)c1ccc(C(=O)OC)c(N)c1 |
| InChI | InChI=1S/C33H42N4O9/c1-3-46-28(38)18-35-32(42)29(39)27(20-45-19-22-12-8-5-9-13-22)37-31(41)26(16-21-10-6-4-7-11-21)36-30(40)23-14-15-24(25(34)17-23)33(43)44-2/h5,8-9,12-15,17,21,26-27H,3-4,6-7,10-11,16,18-20,34H2,1-2H3,(H,35,42)(H,36,40)(H,37,41) |
| InChIKey | GAFMFBMFEMXIHQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 192.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|