C26H38O6 — CID 75215338
[1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 3-hydroxy-2,4,6-trimethyloct-4-enoate (PubChem CID 75215338) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 3-hydroxy-2,4,6-trimethyloct-4-enoate.
| Compound Name | [1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 3-hydroxy-2,4,6-trimethyloct-4-enoate |
|---|---|
| PubChem CID | 75215338 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [1a-(3-hydroxyprop-1-en-2-yl)-7,7a-dimethyl-2-oxo-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-4-yl] 3-hydroxy-2,4,6-trimethyloct-4-enoate |
| SMILES | C=C(CO)C12OC1C1(C)C(=CC2=O)C(OC(=O)C(C)C(O)C(C)=CC(C)CC)CCC1C |
| InChI | InChI=1S/C26H38O6/c1-8-14(2)11-15(3)22(29)18(6)23(30)31-20-10-9-16(4)25(7)19(20)12-21(28)26(17(5)13-27)24(25)32-26/h11-12,14,16,18,20,22,24,27,29H,5,8-10,13H2,1-4,6-7H3 |
| InChIKey | UMDXVAWHWXLGHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|