About methyl 4-acetylocta-2,4-dienoate
methyl 4-acetylocta-2,4-dienoate (PubChem CID 75215425) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 4-acetylocta-2,4-dienoate.
Molecular Properties
| Compound Name | methyl 4-acetylocta-2,4-dienoate |
| PubChem CID | 75215425 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | methyl 4-acetylocta-2,4-dienoate |
| SMILES | CCCC=C(C=CC(=O)OC)C(C)=O |
| InChI | InChI=1S/C11H16O3/c1-4-5-6-10(9(2)12)7-8-11(13)14-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | PEWZIEQJXSUCMC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-acetylocta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-acetylocta-2,4-dienoate?
The IUPAC name of methyl 4-acetylocta-2,4-dienoate (CID 75215425) is methyl 4-acetylocta-2,4-dienoate.
What is the SMILES notation for methyl 4-acetylocta-2,4-dienoate?
The canonical SMILES for methyl 4-acetylocta-2,4-dienoate is CCCC=C(C=CC(=O)OC)C(C)=O.
What is the InChIKey of methyl 4-acetylocta-2,4-dienoate?
The InChIKey is PEWZIEQJXSUCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-5-6-10(9(2)12)7-8-11(13)14-3/h6-8H,4-5H2,1-3H3.
What are the key properties of methyl 4-acetylocta-2,4-dienoate?
methyl 4-acetylocta-2,4-dienoate has a molecular weight of 196.25 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-acetylocta-2,4-dienoate is sourced from PubChem (CID 75215425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).