C15H10F3N3OS — CID 752160
2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 752160) has the molecular formula C15H10F3N3OS and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 752160 |
| Molecular Formula | C15H10F3N3OS |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2ccccc2)nc1SCC(N)=O |
| InChI | InChI=1S/C15H10F3N3OS/c16-15(17,18)11-6-12(9-4-2-1-3-5-9)21-14(10(11)7-19)23-8-13(20)22/h1-6H,8H2,(H2,20,22) |
| InChIKey | DPUJRYUSCJYOIN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |