C27H29N5O — CID 75216713
3-(benzylideneamino)-1-oxo-2-phenyl-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile (PubChem CID 75216713) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-(benzylideneamino)-1-oxo-2-phenyl-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile.
| Compound Name | 3-(benzylideneamino)-1-oxo-2-phenyl-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile |
|---|---|
| PubChem CID | 75216713 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3-(benzylideneamino)-1-oxo-2-phenyl-5-pyrrolidin-1-yl-4a,5,6,7,8,9-hexahydropyrimido[1,6-a]azepine-4-carbonitrile |
| SMILES | N#CC1=C(N=Cc2ccccc2)N(c2ccccc2)C(=O)N2CCCCC(N3CCCC3)C12 |
| InChI | InChI=1S/C27H29N5O/c28-19-23-25-24(30-16-9-10-17-30)15-7-8-18-31(25)27(33)32(22-13-5-2-6-14-22)26(23)29-20-21-11-3-1-4-12-21/h1-6,11-14,20,24-25H,7-10,15-18H2 |
| InChIKey | HFMNTLQZOFMARH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|