C20H25ClN4OS — CID 7522241
2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-[3-(diethylamino)propyl]acetamide (PubChem CID 7522241) has the molecular formula C20H25ClN4OS and a molecular weight of 404.97 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-[3-(diethylamino)propyl]acetamide.
| Compound Name | 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-[3-(diethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 7522241 |
| Molecular Formula | C20H25ClN4OS |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-[3-(diethylamino)propyl]acetamide |
| SMILES | CCN(CC)CCCNC(=O)Cc1csc2nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C20H25ClN4OS/c1-3-24(4-2)11-5-10-22-19(26)12-17-14-27-20-23-18(13-25(17)20)15-6-8-16(21)9-7-15/h6-9,13-14H,3-5,10-12H2,1-2H3,(H,22,26) |
| InChIKey | CCVPAEANYWFYKP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|