C20H27N4OS+ — CID 7522370
diethyl-[3-[[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]propyl]azanium (PubChem CID 7522370) has the molecular formula C20H27N4OS+ and a molecular weight of 371.53 g/mol. Its IUPAC name is diethyl-[3-[[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 7522370 |
| Molecular Formula | C20H27N4OS+ |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | diethyl-[3-[[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)Cc1csc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C20H26N4OS/c1-3-23(4-2)12-8-11-21-19(25)13-17-15-26-20-22-18(14-24(17)20)16-9-6-5-7-10-16/h5-7,9-10,14-15H,3-4,8,11-13H2,1-2H3,(H,21,25)/p+1 |
| InChIKey | VTSUHQVGSYRGLV-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 50.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|