C18H21N3O2 — CID 752242
5,5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-1H-indole]-2',6-dione (PubChem CID 752242) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 5,5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-1H-indole]-2',6-dione.
| Compound Name | 5,5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-1H-indole]-2',6-dione |
|---|---|
| PubChem CID | 752242 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 5,5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-1H-indole]-2',6-dione |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2)N2CC3(C)CN1CC(C)(C2)C3=O |
| InChI | InChI=1S/C18H21N3O2/c1-11-4-5-13-12(6-11)18(15(23)19-13)20-7-16(2)8-21(18)10-17(3,9-20)14(16)22/h4-6H,7-10H2,1-3H3,(H,19,23) |
| InChIKey | QDECVVHDLXRULP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |