About 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline
3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline (PubChem CID 752266) has the molecular formula C16H19ClNO2P
and a molecular weight of 323.76 g/mol. Its IUPAC name is 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline.
Molecular Properties
| Compound Name | 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline |
| PubChem CID | 752266 |
| Molecular Formula | C16H19ClNO2P |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline |
| SMILES | Cc1cc(C)cc(OP(C)(=O)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C16H19ClNO2P/c1-11-8-12(2)10-14(9-11)20-21(4,19)18-16-7-5-6-15(17)13(16)3/h5-10H,1-4H3,(H,18,19) |
| InChIKey | QCVNZHMQNALWMO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline?
The IUPAC name of 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline (CID 752266) is 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline.
What is the SMILES notation for 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline?
The canonical SMILES for 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline is Cc1cc(C)cc(OP(C)(=O)Nc2cccc(Cl)c2C)c1.
What is the InChIKey of 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline?
The InChIKey is QCVNZHMQNALWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClNO2P/c1-11-8-12(2)10-14(9-11)20-21(4,19)18-16-7-5-6-15(17)13(16)3/h5-10H,1-4H3,(H,18,19).
What are the key properties of 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline?
3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline has a molecular weight of 323.76 g/mol, XLogP of 5.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(3,5-dimethylphenoxy)-methylphosphoryl]-2-methylaniline is sourced from PubChem (CID 752266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).