C50H74NO10P — CID 75228710
2-amino-3-[2,3-di(docosa-4,7,10,13,16,19-hexaenoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 75228710) has the molecular formula C50H74NO10P and a molecular weight of 880.11 g/mol. Its IUPAC name is 2-amino-3-[2,3-di(docosa-4,7,10,13,16,19-hexaenoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[2,3-di(docosa-4,7,10,13,16,19-hexaenoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 75228710 |
| Molecular Formula | C50H74NO10P |
| Molecular Weight | 880.11 g/mol |
| Exact Mass | 879.51 |
| IUPAC Name | 2-amino-3-[2,3-di(docosa-4,7,10,13,16,19-hexaenoyloxy)propoxy-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C50H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-48(52)58-43-46(44-59-62(56,57)60-45-47(51)50(54)55)61-49(53)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,29-32,35-38,46-47H,3-4,9-10,15-16,21-22,27-28,33-34,39-45,51H2,1-2H3,(H,54,55)(H,56,57) |
| InChIKey | RJCZACBLQGCNCW-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.11 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|