About (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate
(7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate (PubChem CID 75232135) has the molecular formula C21H30O5
and a molecular weight of 362.47 g/mol. Its IUPAC name is (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate |
| PubChem CID | 75232135 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate |
| SMILES | C=C(C)C1CC(OC(=O)C(C)C)C2(C1)C(C)=CC(=O)C(OC(C)=O)C2C |
| InChI | InChI=1S/C21H30O5/c1-11(2)16-9-18(26-20(24)12(3)4)21(10-16)13(5)8-17(23)19(14(21)6)25-15(7)22/h8,12,14,16,18-19H,1,9-10H2,2-7H3 |
| InChIKey | GXNMXQLIPGCRBF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate?
The IUPAC name of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate (CID 75232135) is (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate.
What is the SMILES notation for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate?
The canonical SMILES for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate is C=C(C)C1CC(OC(=O)C(C)C)C2(C1)C(C)=CC(=O)C(OC(C)=O)C2C.
What is the InChIKey of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate?
The InChIKey is GXNMXQLIPGCRBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O5/c1-11(2)16-9-18(26-20(24)12(3)4)21(10-16)13(5)8-17(23)19(14(21)6)25-15(7)22/h8,12,14,16,18-19H,1,9-10H2,2-7H3.
What are the key properties of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate?
(7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate has a molecular weight of 362.47 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 2-methylpropanoate is sourced from PubChem (CID 75232135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).