About (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate
(7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate (PubChem CID 75232208) has the molecular formula C22H32O5
and a molecular weight of 376.49 g/mol. Its IUPAC name is (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate.
Molecular Properties
| Compound Name | (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate |
| PubChem CID | 75232208 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate |
| SMILES | C=C(C)C1CC(OC(=O)CC(C)C)C2(C1)C(C)=CC(=O)C(OC(C)=O)C2C |
| InChI | InChI=1S/C22H32O5/c1-12(2)8-20(25)27-19-10-17(13(3)4)11-22(19)14(5)9-18(24)21(15(22)6)26-16(7)23/h9,12,15,17,19,21H,3,8,10-11H2,1-2,4-7H3 |
| InChIKey | STNSQOPWOKONNX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate?
The IUPAC name of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate (CID 75232208) is (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate.
What is the SMILES notation for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate?
The canonical SMILES for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate is C=C(C)C1CC(OC(=O)CC(C)C)C2(C1)C(C)=CC(=O)C(OC(C)=O)C2C.
What is the InChIKey of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate?
The InChIKey is STNSQOPWOKONNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O5/c1-12(2)8-20(25)27-19-10-17(13(3)4)11-22(19)14(5)9-18(24)21(15(22)6)26-16(7)23/h9,12,15,17,19,21H,3,8,10-11H2,1-2,4-7H3.
What are the key properties of (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate?
(7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate has a molecular weight of 376.49 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-acetyloxy-6,10-dimethyl-8-oxo-2-prop-1-en-2-ylspiro[4.5]dec-9-en-4-yl) 3-methylbutanoate is sourced from PubChem (CID 75232208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).