C15H25Cl5O — CID 75232223
2,3,5,6,7-pentachloropentadec-14-en-4-ol (PubChem CID 75232223) has the molecular formula C15H25Cl5O and a molecular weight of 398.63 g/mol. Its IUPAC name is 2,3,5,6,7-pentachloropentadec-14-en-4-ol.
| Compound Name | 2,3,5,6,7-pentachloropentadec-14-en-4-ol |
|---|---|
| PubChem CID | 75232223 |
| Molecular Formula | C15H25Cl5O |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2,3,5,6,7-pentachloropentadec-14-en-4-ol |
| SMILES | C=CCCCCCCC(Cl)C(Cl)C(Cl)C(O)C(Cl)C(C)Cl |
| InChI | InChI=1S/C15H25Cl5O/c1-3-4-5-6-7-8-9-11(17)13(19)14(20)15(21)12(18)10(2)16/h3,10-15,21H,1,4-9H2,2H3 |
| InChIKey | ZTMHOLOLVATDHU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|