C17H20N2O4 — CID 75232504
(3,4-dimethyl-2,5-dioxopyrrol-1-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 75232504) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (3,4-dimethyl-2,5-dioxopyrrol-1-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (3,4-dimethyl-2,5-dioxopyrrol-1-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 75232504 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3,4-dimethyl-2,5-dioxopyrrol-1-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C#N)=CC1C(C(=O)OCN2C(=O)C(C)=C(C)C2=O)C1(C)C |
| InChI | InChI=1S/C17H20N2O4/c1-9(7-18)6-12-13(17(12,4)5)16(22)23-8-19-14(20)10(2)11(3)15(19)21/h6,12-13H,8H2,1-5H3 |
| InChIKey | GLJCZBQKCIVYBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|