C19H22N2O4 — CID 75232505
(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 75232505) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 75232505 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C#N)=CC1C(C(=O)OCN2C(=O)C3=C(CCCC3)C2=O)C1(C)C |
| InChI | InChI=1S/C19H22N2O4/c1-11(9-20)8-14-15(19(14,2)3)18(24)25-10-21-16(22)12-6-4-5-7-13(12)17(21)23/h8,14-15H,4-7,10H2,1-3H3 |
| InChIKey | IPZSAYZBXGSNHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|