C34H32O10 — CID 75237022
2,3,8,11,12,16-hexamethoxy-6,14-diphenyldispiro[4.3.49.35]hexadeca-2,7,11,15-tetraene-1,4,10,13-tetrone (PubChem CID 75237022) has the molecular formula C34H32O10 and a molecular weight of 600.62 g/mol. Its IUPAC name is 2,3,8,11,12,16-hexamethoxy-6,14-diphenyldispiro[4.3.49.35]hexadeca-2,7,11,15-tetraene-1,4,10,13-tetrone.
| Compound Name | 2,3,8,11,12,16-hexamethoxy-6,14-diphenyldispiro[4.3.49.35]hexadeca-2,7,11,15-tetraene-1,4,10,13-tetrone |
|---|---|
| PubChem CID | 75237022 |
| Molecular Formula | C34H32O10 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2,3,8,11,12,16-hexamethoxy-6,14-diphenyldispiro[4.3.49.35]hexadeca-2,7,11,15-tetraene-1,4,10,13-tetrone |
| SMILES | COC1=CC(c2ccccc2)C2(C(=O)C(OC)=C(OC)C2=O)C(OC)=CC(c2ccccc2)C12C(=O)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C34H32O10/c1-39-23-17-21(19-13-9-7-10-14-19)34(31(37)27(43-5)28(44-6)32(34)38)24(40-2)18-22(20-15-11-8-12-16-20)33(23)29(35)25(41-3)26(42-4)30(33)36/h7-18,21-22H,1-6H3 |
| InChIKey | OASRMBZSJNAYKB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|