C47H42N4O9 — CID 75237728
methyl 4-[3,5-bis[(8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenoxy]butanoate (PubChem CID 75237728) has the molecular formula C47H42N4O9 and a molecular weight of 806.87 g/mol. Its IUPAC name is methyl 4-[3,5-bis[(8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenoxy]butanoate.
| Compound Name | methyl 4-[3,5-bis[(8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 75237728 |
| Molecular Formula | C47H42N4O9 |
| Molecular Weight | 806.87 g/mol |
| Exact Mass | 806.30 |
| IUPAC Name | methyl 4-[3,5-bis[(8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl)oxymethyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cc(COc2cc3c(cc2OC)C(=O)N2c4ccccc4CC2C=N3)cc(COc2cc3c(cc2OC)C(=O)N2c4ccccc4CC2C=N3)c1 |
| InChI | InChI=1S/C47H42N4O9/c1-55-41-20-35-37(48-24-32-18-30-9-4-6-11-39(30)50(32)46(35)53)22-43(41)59-26-28-15-29(17-34(16-28)58-14-8-13-45(52)57-3)27-60-44-23-38-36(21-42(44)56-2)47(54)51-33(25-49-38)19-31-10-5-7-12-40(31)51/h4-7,9-12,15-17,20-25,32-33H,8,13-14,18-19,26-27H2,1-3H3 |
| InChIKey | GTJXQPBJMDTBNK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 137.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|