C30H30F11NO6 — CID 75238831
N-(4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-1-[4-[2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]ethenyl]phenyl]methanimine (PubChem CID 75238831) has the molecular formula C30H30F11NO6 and a molecular weight of 709.55 g/mol. Its IUPAC name is N-(4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-1-[4-[2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]ethenyl]phenyl]methanimine.
| Compound Name | N-(4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-1-[4-[2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]ethenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 75238831 |
| Molecular Formula | C30H30F11NO6 |
| Molecular Weight | 709.55 g/mol |
| Exact Mass | 709.19 |
| IUPAC Name | N-(4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl)oxy-1-[4-[2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]ethenyl]phenyl]methanimine |
| SMILES | CCOC1C(OC)C(C)OC(ON=Cc2ccc(C=Cc3ccc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)C1OC |
| InChI | InChI=1S/C30H30F11NO6/c1-5-45-23-22(43-3)17(2)46-25(24(23)44-4)47-42-16-20-10-8-18(9-11-20)6-7-19-12-14-21(15-13-19)26(31,32)29(38,39)48-30(40,41)27(33,34)28(35,36)37/h6-17,22-25H,5H2,1-4H3 |
| InChIKey | QQARNAQZUQIYQP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.55 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|