C25H21ClF4N2O5S — CID 75240250
4-[3-chloro-4-[3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-2-fluorobenzoic acid (PubChem CID 75240250) has the molecular formula C25H21ClF4N2O5S and a molecular weight of 572.96 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-chloro-4-[3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 75240250 |
| Molecular Formula | C25H21ClF4N2O5S |
| Molecular Weight | 572.96 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 4-[3-chloro-4-[3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-2-fluorobenzoic acid |
| SMILES | CC(c1ccc(-c2ccc(C(=O)O)c(F)c2)cc1Cl)C(O)(c1ccc2c(c1)N(C)S(=O)(=O)N2C)C(F)(F)F |
| InChI | InChI=1S/C25H21ClF4N2O5S/c1-13(17-7-4-14(10-19(17)26)15-5-8-18(23(33)34)20(27)11-15)24(35,25(28,29)30)16-6-9-21-22(12-16)32(3)38(36,37)31(21)2/h4-13,35H,1-3H3,(H,33,34) |
| InChIKey | UOCCJRHEMWTTLK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |