C21H21FN2O4 — CID 75242276
3-[5-(4-fluorophenyl)-5-methoxyiminopentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 75242276) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-5-methoxyiminopentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-(4-fluorophenyl)-5-methoxyiminopentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 75242276 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-5-methoxyiminopentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CON=C(CCCC(=O)N1C(=O)OCC1c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O4/c1-27-23-18(15-10-12-17(22)13-11-15)8-5-9-20(25)24-19(14-28-21(24)26)16-6-3-2-4-7-16/h2-4,6-7,10-13,19H,5,8-9,14H2,1H3 |
| InChIKey | XXZHJJACHSIOTC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|