C54H72N2O14+2 — CID 75243535
bis[3-[6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate (PubChem CID 75243535) has the molecular formula C54H72N2O14+2 and a molecular weight of 973.17 g/mol. Its IUPAC name is bis[3-[6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate.
| Compound Name | bis[3-[6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate |
|---|---|
| PubChem CID | 75243535 |
| Molecular Formula | C54H72N2O14+2 |
| Molecular Weight | 973.17 g/mol |
| Exact Mass | 972.50 |
| IUPAC Name | bis[3-[6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate |
| SMILES | COc1cc2c(cc1OC)C(Cc1cc(OC)c(OC)c(OC)c1)[N+](C)(CCCOC(=O)C=CC(=O)OCCC[N+]1(C)CCc3cc(OC)c(OC)cc3C1Cc1cc(OC)c(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C54H72N2O14/c1-55(21-17-37-31-43(59-3)45(61-5)33-39(37)41(55)25-35-27-47(63-7)53(67-11)48(28-35)64-8)19-13-23-69-51(57)15-16-52(58)70-24-14-20-56(2)22-18-38-32-44(60-4)46(62-6)34-40(38)42(56)26-36-29-49(65-9)54(68-12)50(30-36)66-10/h15-16,27-34,41-42H,13-14,17-26H2,1-12H3/q+2 |
| InChIKey | OFVYOXZOYILSJD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.17 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|