About N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide (PubChem CID 752437) has the molecular formula C15H15N3OS
and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide |
| PubChem CID | 752437 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C15H15N3OS/c1-10(2)14(19)16-12-5-3-4-11(8-12)13-9-18-6-7-20-15(18)17-13/h3-10H,1-2H3,(H,16,19) |
| InChIKey | GACXKBYMPFKXEK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide?
The IUPAC name of N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide (CID 752437) is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide.
What is the SMILES notation for N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide?
The canonical SMILES for N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide is CC(C)C(=O)Nc1cccc(-c2cn3ccsc3n2)c1.
What is the InChIKey of N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide?
The InChIKey is GACXKBYMPFKXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3OS/c1-10(2)14(19)16-12-5-3-4-11(8-12)13-9-18-6-7-20-15(18)17-13/h3-10H,1-2H3,(H,16,19).
What are the key properties of N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide?
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide has a molecular weight of 285.37 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-methylpropanamide is sourced from PubChem (CID 752437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).