About (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate
(9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate (PubChem CID 75244856) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate.
Molecular Properties
| Compound Name | (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate |
| PubChem CID | 75244856 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCC3C(C=C(C=O)CCC1O2)C3(C)C |
| InChI | InChI=1S/C17H24O4/c1-11(19)20-10-17-7-6-13-14(16(13,2)3)8-12(9-18)4-5-15(17)21-17/h8-9,13-15H,4-7,10H2,1-3H3 |
| InChIKey | UFFUHXLOFAGFNB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate?
The IUPAC name of (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate (CID 75244856) is (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate.
What is the SMILES notation for (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate?
The canonical SMILES for (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate is CC(=O)OCC12CCC3C(C=C(C=O)CCC1O2)C3(C)C.
What is the InChIKey of (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate?
The InChIKey is UFFUHXLOFAGFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-11(19)20-10-17-7-6-13-14(16(13,2)3)8-12(9-18)4-5-15(17)21-17/h8-9,13-15H,4-7,10H2,1-3H3.
What are the key properties of (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate?
(9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate has a molecular weight of 292.38 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl)methyl acetate is sourced from PubChem (CID 75244856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).