About 4-azatricyclo[5.2.1.02,6]deca-3,8-diene
4-azatricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 75251148) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 4-azatricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | 4-azatricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 75251148 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4-azatricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2CC1C1C=NCC21 |
| InChI | InChI=1S/C9H11N/c1-2-7-3-6(1)8-4-10-5-9(7)8/h1-2,4,6-9H,3,5H2 |
| InChIKey | MKYMCHGSSXMPHP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-azatricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of 4-azatricyclo[5.2.1.02,6]deca-3,8-diene (CID 75251148) is 4-azatricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for 4-azatricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for 4-azatricyclo[5.2.1.02,6]deca-3,8-diene is C1=CC2CC1C1C=NCC21.
What is the InChIKey of 4-azatricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is MKYMCHGSSXMPHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-2-7-3-6(1)8-4-10-5-9(7)8/h1-2,4,6-9H,3,5H2.
What are the key properties of 4-azatricyclo[5.2.1.02,6]deca-3,8-diene?
4-azatricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 133.19 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 75251148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).