C9H11NO4 — CID 75251326
1-acetyl-3,4,4a,7a-tetrahydro-2H-furo[3,4-b]pyridine-5,7-dione (PubChem CID 75251326) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 1-acetyl-3,4,4a,7a-tetrahydro-2H-furo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-acetyl-3,4,4a,7a-tetrahydro-2H-furo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 75251326 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-acetyl-3,4,4a,7a-tetrahydro-2H-furo[3,4-b]pyridine-5,7-dione |
| SMILES | CC(=O)N1CCCC2C(=O)OC(=O)C21 |
| InChI | InChI=1S/C9H11NO4/c1-5(11)10-4-2-3-6-7(10)9(13)14-8(6)12/h6-7H,2-4H2,1H3 |
| InChIKey | XIXSKLYYDKTQRI-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|