C21H27N3O2 — CID 7525282
1-cyclohexyl-3-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]urea (PubChem CID 7525282) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 7525282 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-cyclohexyl-3-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]urea |
| SMILES | O=C(NC[C@@H](c1ccco1)N1CCc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C21H27N3O2/c25-21(23-17-8-2-1-3-9-17)22-15-19(20-11-6-14-26-20)24-13-12-16-7-4-5-10-18(16)24/h4-7,10-11,14,17,19H,1-3,8-9,12-13,15H2,(H2,22,23,25)/t19-/m0/s1 |
| InChIKey | JJEFVCQBKLCBFL-IBGZPJMESA-N |
| XLogP | 4.02 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |