C23H24N2O3 — CID 7525308
N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]-4-ethoxybenzamide (PubChem CID 7525308) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]-4-ethoxybenzamide.
| Compound Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 7525308 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-(furan-2-yl)ethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC[C@@H](c2ccco2)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-2-27-19-11-9-18(10-12-19)23(26)24-16-21(22-8-5-15-28-22)25-14-13-17-6-3-4-7-20(17)25/h3-12,15,21H,2,13-14,16H2,1H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | JKIWATPBYMGZER-NRFANRHFSA-N |
| XLogP | 4.21 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |