C34H55NO4 — CID 75253500
10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-[(2-methylpropan-2-yl)oxy]-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide (PubChem CID 75253500) has the molecular formula C34H55NO4 and a molecular weight of 541.82 g/mol. Its IUPAC name is 10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-[(2-methylpropan-2-yl)oxy]-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide.
| Compound Name | 10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-[(2-methylpropan-2-yl)oxy]-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 75253500 |
| Molecular Formula | C34H55NO4 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.41 |
| IUPAC Name | 10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-[(2-methylpropan-2-yl)oxy]-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
| SMILES | CC(C)(C)ONC(=O)C1(C)CCC2(C)CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C34H55NO4/c1-28(2,3)39-35-27(38)31(7)16-15-30(6)17-18-33(9)21(22(30)20-31)19-23(36)26-32(8)13-12-25(37)29(4,5)24(32)11-14-34(26,33)10/h19,22,24-26,37H,11-18,20H2,1-10H3,(H,35,38) |
| InChIKey | PRXUCWAGKFUMRP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|