C21H18ClF3N4O5S — CID 75253914
N-[4-[3-chloro-4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 75253914) has the molecular formula C21H18ClF3N4O5S and a molecular weight of 530.91 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 75253914 |
| Molecular Formula | C21H18ClF3N4O5S |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | N-[4-[3-chloro-4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | CC1=C(CC(=O)Nc2nc(-c3ccc(OC(F)(F)F)c(Cl)c3)cs2)C2C(=O)N(C)C(=O)N(C)C2O1 |
| InChI | InChI=1S/C21H18ClF3N4O5S/c1-9-11(16-17(31)28(2)20(32)29(3)18(16)33-9)7-15(30)27-19-26-13(8-35-19)10-4-5-14(12(22)6-10)34-21(23,24)25/h4-6,8,16,18H,7H2,1-3H3,(H,26,27,30) |
| InChIKey | YTLVQUMLWNXVPA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |